C17H21N3O4S2 — CID 92661298
(2S)-2-(4-methoxy-N-methylsulfonylanilino)-N-[(Z)-(3-methylthiophen-2-yl)methylideneamino]propanamide (PubChem CID 92661298) has the molecular formula C17H21N3O4S2 and a molecular weight of 395.51 g/mol. Its IUPAC name is (2S)-2-(4-methoxy-N-methylsulfonylanilino)-N-[(Z)-(3-methylthiophen-2-yl)methylideneamino]propanamide.
| Compound Name | (2S)-2-(4-methoxy-N-methylsulfonylanilino)-N-[(Z)-(3-methylthiophen-2-yl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 92661298 |
| Molecular Formula | C17H21N3O4S2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | (2S)-2-(4-methoxy-N-methylsulfonylanilino)-N-[(Z)-(3-methylthiophen-2-yl)methylideneamino]propanamide |
| SMILES | COc1ccc(N([C@@H](C)C(=O)N/N=C\c2sccc2C)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H21N3O4S2/c1-12-9-10-25-16(12)11-18-19-17(21)13(2)20(26(4,22)23)14-5-7-15(24-3)8-6-14/h5-11,13H,1-4H3,(H,19,21)/b18-11-/t13-/m0/s1 |
| InChIKey | HWUQZSQEUZNRLO-FHNWIRHTSA-N |
| XLogP | 2.37 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|