C24H26Cl2N4O4S — CID 94855010
(2R)-N-[(Z)-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(4-methoxy-N-methylsulfonylanilino)propanamide (PubChem CID 94855010) has the molecular formula C24H26Cl2N4O4S and a molecular weight of 537.47 g/mol. Its IUPAC name is (2R)-N-[(Z)-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(4-methoxy-N-methylsulfonylanilino)propanamide.
| Compound Name | (2R)-N-[(Z)-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(4-methoxy-N-methylsulfonylanilino)propanamide |
|---|---|
| PubChem CID | 94855010 |
| Molecular Formula | C24H26Cl2N4O4S |
| Molecular Weight | 537.47 g/mol |
| Exact Mass | 536.11 |
| IUPAC Name | (2R)-N-[(Z)-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(4-methoxy-N-methylsulfonylanilino)propanamide |
| SMILES | COc1ccc(N([C@H](C)C(=O)N/N=C\c2cc(C)n(-c3cccc(Cl)c3Cl)c2C)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C24H26Cl2N4O4S/c1-15-13-18(16(2)29(15)22-8-6-7-21(25)23(22)26)14-27-28-24(31)17(3)30(35(5,32)33)19-9-11-20(34-4)12-10-19/h6-14,17H,1-5H3,(H,28,31)/b27-14-/t17-/m1/s1 |
| InChIKey | DPNGAXLWSOWMMQ-MWQSPYHUSA-N |
| XLogP | 4.71 |
| TPSA | 93.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.47 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|