C19H20N2O3 — CID 6588159
trans-(1S,2S)-N-[(Z)-(2,5-dimethoxyphenyl)methylideneamino]-2-phenylcyclopropane-1-carboxamide (PubChem CID 6588159) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is trans-(1S,2S)-N-[(Z)-(2,5-dimethoxyphenyl)methylideneamino]-2-phenylcyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2S)-N-[(Z)-(2,5-dimethoxyphenyl)methylideneamino]-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 6588159 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | trans-(1S,2S)-N-[(Z)-(2,5-dimethoxyphenyl)methylideneamino]-2-phenylcyclopropane-1-carboxamide |
| SMILES | COc1ccc(OC)c(/C=N\NC(=O)[C@H]2C[C@@H]2c2ccccc2)c1 |
| InChI | InChI=1S/C19H20N2O3/c1-23-15-8-9-18(24-2)14(10-15)12-20-21-19(22)17-11-16(17)13-6-4-3-5-7-13/h3-10,12,16-17H,11H2,1-2H3,(H,21,22)/b20-12-/t16-,17+/m1/s1 |
| InChIKey | GBZBGTJRTJTOPZ-KKQVRFOCSA-N |
| XLogP | 2.96 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|