C24H22Cl2N4O4 — CID 94837449
N-[(E)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoacetamide (PubChem CID 94837449) has the molecular formula C24H22Cl2N4O4 and a molecular weight of 501.37 g/mol. Its IUPAC name is N-[(E)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoacetamide.
| Compound Name | N-[(E)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 94837449 |
| Molecular Formula | C24H22Cl2N4O4 |
| Molecular Weight | 501.37 g/mol |
| Exact Mass | 500.10 |
| IUPAC Name | N-[(E)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoacetamide |
| SMILES | COc1ccccc1N1CCN(C(=O)C(=O)N/N=C/c2ccc(-c3ccc(Cl)c(Cl)c3)o2)CC1 |
| InChI | InChI=1S/C24H22Cl2N4O4/c1-33-22-5-3-2-4-20(22)29-10-12-30(13-11-29)24(32)23(31)28-27-15-17-7-9-21(34-17)16-6-8-18(25)19(26)14-16/h2-9,14-15H,10-13H2,1H3,(H,28,31)/b27-15+ |
| InChIKey | FRTKORZHWCJAIK-JFLMPSFJSA-N |
| XLogP | 4.06 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|