C26H27Cl2N5O3 — CID 98091140
N-[(Z)-[1-(3,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoacetamide (PubChem CID 98091140) has the molecular formula C26H27Cl2N5O3 and a molecular weight of 528.44 g/mol. Its IUPAC name is N-[(Z)-[1-(3,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoacetamide.
| Compound Name | N-[(Z)-[1-(3,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 98091140 |
| Molecular Formula | C26H27Cl2N5O3 |
| Molecular Weight | 528.44 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | N-[(Z)-[1-(3,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoacetamide |
| SMILES | COc1ccccc1N1CCN(C(=O)C(=O)N/N=C\c2cc(C)n(-c3cc(Cl)cc(Cl)c3)c2C)CC1 |
| InChI | InChI=1S/C26H27Cl2N5O3/c1-17-12-19(18(2)33(17)22-14-20(27)13-21(28)15-22)16-29-30-25(34)26(35)32-10-8-31(9-11-32)23-6-4-5-7-24(23)36-3/h4-7,12-16H,8-11H2,1-3H3,(H,30,34)/b29-16- |
| InChIKey | JTFZKMNBUSTFDY-MWLSYYOVSA-N |
| XLogP | 4.21 |
| TPSA | 79.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|