C27H30Cl2N2O3 — CID 5190552
N-[[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetamide (PubChem CID 5190552) has the molecular formula C27H30Cl2N2O3 and a molecular weight of 501.45 g/mol. Its IUPAC name is N-[[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetamide.
| Compound Name | N-[[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 5190552 |
| Molecular Formula | C27H30Cl2N2O3 |
| Molecular Weight | 501.45 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | N-[[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetamide |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(OCC(=O)NN=Cc2ccc(-c3ccc(Cl)c(Cl)c3)o2)cc1 |
| InChI | InChI=1S/C27H30Cl2N2O3/c1-26(2,3)17-27(4,5)19-7-9-20(10-8-19)33-16-25(32)31-30-15-21-11-13-24(34-21)18-6-12-22(28)23(29)14-18/h6-15H,16-17H2,1-5H3,(H,31,32) |
| InChIKey | BMIAIPHLIHAWGJ-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.45 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|