C27H31IN2O3 — CID 4145142
N-[[5-(4-iodophenyl)furan-2-yl]methylideneamino]-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetamide (PubChem CID 4145142) has the molecular formula C27H31IN2O3 and a molecular weight of 558.46 g/mol. Its IUPAC name is N-[[5-(4-iodophenyl)furan-2-yl]methylideneamino]-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetamide.
| Compound Name | N-[[5-(4-iodophenyl)furan-2-yl]methylideneamino]-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 4145142 |
| Molecular Formula | C27H31IN2O3 |
| Molecular Weight | 558.46 g/mol |
| Exact Mass | 558.14 |
| IUPAC Name | N-[[5-(4-iodophenyl)furan-2-yl]methylideneamino]-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetamide |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(OCC(=O)NN=Cc2ccc(-c3ccc(I)cc3)o2)cc1 |
| InChI | InChI=1S/C27H31IN2O3/c1-26(2,3)18-27(4,5)20-8-12-22(13-9-20)32-17-25(31)30-29-16-23-14-15-24(33-23)19-6-10-21(28)11-7-19/h6-16H,17-18H2,1-5H3,(H,30,31) |
| InChIKey | UASRKSHECXVDTD-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.46 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|