C24H29N2O4- — CID 4592923
4-[[[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetyl]hydrazinylidene]methyl]benzoate (PubChem CID 4592923) has the molecular formula C24H29N2O4- and a molecular weight of 409.51 g/mol. Its IUPAC name is 4-[[[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetyl]hydrazinylidene]methyl]benzoate.
| Compound Name | 4-[[[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetyl]hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 4592923 |
| Molecular Formula | C24H29N2O4- |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | 4-[[[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetyl]hydrazinylidene]methyl]benzoate |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(OCC(=O)NN=Cc2ccc(C(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C24H30N2O4/c1-23(2,3)16-24(4,5)19-10-12-20(13-11-19)30-15-21(27)26-25-14-17-6-8-18(9-7-17)22(28)29/h6-14H,15-16H2,1-5H3,(H,26,27)(H,28,29)/p-1 |
| InChIKey | AFIZLZSOCXYQFQ-UHFFFAOYSA-M |
| XLogP | 3.29 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|