C30H33N3O6 — CID 6321684
[4-[(Z)-[[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate (PubChem CID 6321684) has the molecular formula C30H33N3O6 and a molecular weight of 531.61 g/mol. Its IUPAC name is [4-[(Z)-[[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate.
| Compound Name | [4-[(Z)-[[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 6321684 |
| Molecular Formula | C30H33N3O6 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.24 |
| IUPAC Name | [4-[(Z)-[[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(OCC(=O)N/N=C\c2ccc(OC(=O)c3ccc([N+](=O)[O-])cc3)cc2)cc1 |
| InChI | InChI=1S/C30H33N3O6/c1-29(2,3)20-30(4,5)23-10-16-25(17-11-23)38-19-27(34)32-31-18-21-6-14-26(15-7-21)39-28(35)22-8-12-24(13-9-22)33(36)37/h6-18H,19-20H2,1-5H3,(H,32,34)/b31-18- |
| InChIKey | DYLCSYGEKZMQSE-MNBJERMJSA-N |
| XLogP | 6.06 |
| TPSA | 120.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|