C24H20N4O3S — CID 6182173
(E)-N-[2-(1H-indol-3-yl)ethyl]-3-(3-nitro-4-pyridin-2-ylsulfanylphenyl)prop-2-enamide (PubChem CID 6182173) has the molecular formula C24H20N4O3S and a molecular weight of 444.52 g/mol. Its IUPAC name is (E)-N-[2-(1H-indol-3-yl)ethyl]-3-(3-nitro-4-pyridin-2-ylsulfanylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-(1H-indol-3-yl)ethyl]-3-(3-nitro-4-pyridin-2-ylsulfanylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6182173 |
| Molecular Formula | C24H20N4O3S |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | (E)-N-[2-(1H-indol-3-yl)ethyl]-3-(3-nitro-4-pyridin-2-ylsulfanylphenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Sc2ccccn2)c([N+](=O)[O-])c1)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C24H20N4O3S/c29-23(25-14-12-18-16-27-20-6-2-1-5-19(18)20)11-9-17-8-10-22(21(15-17)28(30)31)32-24-7-3-4-13-26-24/h1-11,13,15-16,27H,12,14H2,(H,25,29)/b11-9+ |
| InChIKey | PBIZUFPQMPQVSN-PKNBQFBNSA-N |
| XLogP | 4.99 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|