C12H11ClN2O3 — CID 54784956
(E)-3-(2-chloro-4,5-dimethoxyphenyl)-2-cyanoprop-2-enamide (PubChem CID 54784956) has the molecular formula C12H11ClN2O3 and a molecular weight of 266.68 g/mol. Its IUPAC name is (E)-3-(2-chloro-4,5-dimethoxyphenyl)-2-cyanoprop-2-enamide.
| Compound Name | (E)-3-(2-chloro-4,5-dimethoxyphenyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 54784956 |
| Molecular Formula | C12H11ClN2O3 |
| Molecular Weight | 266.68 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | (E)-3-(2-chloro-4,5-dimethoxyphenyl)-2-cyanoprop-2-enamide |
| SMILES | COc1cc(Cl)c(/C=C(\C#N)C(N)=O)cc1OC |
| InChI | InChI=1S/C12H11ClN2O3/c1-17-10-4-7(3-8(6-14)12(15)16)9(13)5-11(10)18-2/h3-5H,1-2H3,(H2,15,16)/b8-3+ |
| InChIKey | OAAWSKIAWJNHKU-FPYGCLRLSA-N |
| XLogP | 1.75 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.68 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|