C21H18N2O3 — CID 2384659
ethyl (E)-2-cyano-3-[4-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]prop-2-enoate (PubChem CID 2384659) has the molecular formula C21H18N2O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-[4-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-[4-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 2384659 |
| Molecular Formula | C21H18N2O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | ethyl (E)-2-cyano-3-[4-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/c1ccc(NC(=O)/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C21H18N2O3/c1-2-26-21(25)18(15-22)14-17-8-11-19(12-9-17)23-20(24)13-10-16-6-4-3-5-7-16/h3-14H,2H2,1H3,(H,23,24)/b13-10+,18-14+ |
| InChIKey | OXDZDCUFJZAITM-BHTJOUODSA-N |
| XLogP | 3.81 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|