C17H12ClN3O — CID 74376737
3-(4-chlorophenyl)-1-[4-(1,2,4-triazol-1-yl)phenyl]prop-2-en-1-one (PubChem CID 74376737) has the molecular formula C17H12ClN3O and a molecular weight of 309.76 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-[4-(1,2,4-triazol-1-yl)phenyl]prop-2-en-1-one.
| Compound Name | 3-(4-chlorophenyl)-1-[4-(1,2,4-triazol-1-yl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 74376737 |
| Molecular Formula | C17H12ClN3O |
| Molecular Weight | 309.76 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 3-(4-chlorophenyl)-1-[4-(1,2,4-triazol-1-yl)phenyl]prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc(Cl)cc1)c1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C17H12ClN3O/c18-15-6-1-13(2-7-15)3-10-17(22)14-4-8-16(9-5-14)21-12-19-11-20-21/h1-12H |
| InChIKey | LRIWRPHAHUONAV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.76 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|