C22H23BrFN3O3 — CID 3285468
[2-(4-bromo-2-fluoroanilino)-2-oxoethyl] 2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]prop-2-enoate (PubChem CID 3285468) has the molecular formula C22H23BrFN3O3 and a molecular weight of 476.35 g/mol. Its IUPAC name is [2-(4-bromo-2-fluoroanilino)-2-oxoethyl] 2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]prop-2-enoate.
| Compound Name | [2-(4-bromo-2-fluoroanilino)-2-oxoethyl] 2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 3285468 |
| Molecular Formula | C22H23BrFN3O3 |
| Molecular Weight | 476.35 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | [2-(4-bromo-2-fluoroanilino)-2-oxoethyl] 2-cyano-3-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]prop-2-enoate |
| SMILES | Cc1cc(C=C(C#N)C(=O)OCC(=O)Nc2ccc(Br)cc2F)c(C)n1CC(C)C |
| InChI | InChI=1S/C22H23BrFN3O3/c1-13(2)11-27-14(3)7-16(15(27)4)8-17(10-25)22(29)30-12-21(28)26-20-6-5-18(23)9-19(20)24/h5-9,13H,11-12H2,1-4H3,(H,26,28) |
| InChIKey | APZUAFGCMZSHRH-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 84.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.35 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|