C25H25N5O5S — CID 170916045
(Z)-3-[4-[2-(4-acetamidophenoxy)ethoxy]-3-ethoxyphenyl]-2-cyano-N-(5-methyl-1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 170916045) has the molecular formula C25H25N5O5S and a molecular weight of 507.57 g/mol. Its IUPAC name is (Z)-3-[4-[2-(4-acetamidophenoxy)ethoxy]-3-ethoxyphenyl]-2-cyano-N-(5-methyl-1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | (Z)-3-[4-[2-(4-acetamidophenoxy)ethoxy]-3-ethoxyphenyl]-2-cyano-N-(5-methyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170916045 |
| Molecular Formula | C25H25N5O5S |
| Molecular Weight | 507.57 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | (Z)-3-[4-[2-(4-acetamidophenoxy)ethoxy]-3-ethoxyphenyl]-2-cyano-N-(5-methyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)Nc2nnc(C)s2)ccc1OCCOc1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C25H25N5O5S/c1-4-33-23-14-18(13-19(15-26)24(32)28-25-30-29-17(3)36-25)5-10-22(23)35-12-11-34-21-8-6-20(7-9-21)27-16(2)31/h5-10,13-14H,4,11-12H2,1-3H3,(H,27,31)(H,28,30,32)/b19-13- |
| InChIKey | DONSQFMCFFZXGA-UYRXBGFRSA-N |
| XLogP | 4.21 |
| TPSA | 135.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.57 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|