C29H29F3N4O4S — CID 171331332
2-cyano-3-[4-[2-(4-cyclohexylphenoxy)ethoxy]-3-ethoxyphenyl]-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide (PubChem CID 171331332) has the molecular formula C29H29F3N4O4S and a molecular weight of 586.64 g/mol. Its IUPAC name is 2-cyano-3-[4-[2-(4-cyclohexylphenoxy)ethoxy]-3-ethoxyphenyl]-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide.
| Compound Name | 2-cyano-3-[4-[2-(4-cyclohexylphenoxy)ethoxy]-3-ethoxyphenyl]-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 171331332 |
| Molecular Formula | C29H29F3N4O4S |
| Molecular Weight | 586.64 g/mol |
| Exact Mass | 586.19 |
| IUPAC Name | 2-cyano-3-[4-[2-(4-cyclohexylphenoxy)ethoxy]-3-ethoxyphenyl]-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide |
| SMILES | CCOc1cc(C=C(C#N)C(=O)Nc2nnc(C(F)(F)F)s2)ccc1OCCOc1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C29H29F3N4O4S/c1-2-38-25-17-19(16-22(18-33)26(37)34-28-36-35-27(41-28)29(30,31)32)8-13-24(25)40-15-14-39-23-11-9-21(10-12-23)20-6-4-3-5-7-20/h8-13,16-17,20H,2-7,14-15H2,1H3,(H,34,36,37) |
| InChIKey | NZOHADWXWVAZKA-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 106.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.64 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|