C25H24Cl2N4O4S — CID 170912359
(Z)-2-cyano-3-[3,5-dichloro-4-[2-(2-methoxyphenoxy)ethoxy]phenyl]-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide (PubChem CID 170912359) has the molecular formula C25H24Cl2N4O4S and a molecular weight of 547.46 g/mol. Its IUPAC name is (Z)-2-cyano-3-[3,5-dichloro-4-[2-(2-methoxyphenoxy)ethoxy]phenyl]-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[3,5-dichloro-4-[2-(2-methoxyphenoxy)ethoxy]phenyl]-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 170912359 |
| Molecular Formula | C25H24Cl2N4O4S |
| Molecular Weight | 547.46 g/mol |
| Exact Mass | 546.09 |
| IUPAC Name | (Z)-2-cyano-3-[3,5-dichloro-4-[2-(2-methoxyphenoxy)ethoxy]phenyl]-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide |
| SMILES | COc1ccccc1OCCOc1c(Cl)cc(/C=C(/C#N)C(=O)Nc2nnc(CC(C)C)s2)cc1Cl |
| InChI | InChI=1S/C25H24Cl2N4O4S/c1-15(2)10-22-30-31-25(36-22)29-24(32)17(14-28)11-16-12-18(26)23(19(27)13-16)35-9-8-34-21-7-5-4-6-20(21)33-3/h4-7,11-13,15H,8-10H2,1-3H3,(H,29,31,32)/b17-11- |
| InChIKey | DLWKDMPPLATACO-BOPFTXTBSA-N |
| XLogP | 6.06 |
| TPSA | 106.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.46 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|