C15H18N2O3 — CID 19183544
(Z)-2-cyano-3-(2,5-dimethoxyphenyl)-N-propylprop-2-enamide (PubChem CID 19183544) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is (Z)-2-cyano-3-(2,5-dimethoxyphenyl)-N-propylprop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(2,5-dimethoxyphenyl)-N-propylprop-2-enamide |
|---|---|
| PubChem CID | 19183544 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | (Z)-2-cyano-3-(2,5-dimethoxyphenyl)-N-propylprop-2-enamide |
| SMILES | CCCNC(=O)/C(C#N)=C\c1cc(OC)ccc1OC |
| InChI | InChI=1S/C15H18N2O3/c1-4-7-17-15(18)12(10-16)8-11-9-13(19-2)5-6-14(11)20-3/h5-6,8-9H,4,7H2,1-3H3,(H,17,18)/b12-8- |
| InChIKey | RGPJMXWZCWPCFU-WQLSENKSSA-N |
| XLogP | 2.14 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|