C21H18FN3 — CID 3554169
3-[2,5-dimethyl-1-(4-methyl-2-pyridinyl)pyrrol-3-yl]-2-(2-fluorophenyl)prop-2-enenitrile (PubChem CID 3554169) has the molecular formula C21H18FN3 and a molecular weight of 331.39 g/mol. Its IUPAC name is 3-[2,5-dimethyl-1-(4-methyl-2-pyridinyl)pyrrol-3-yl]-2-(2-fluorophenyl)prop-2-enenitrile.
| Compound Name | 3-[2,5-dimethyl-1-(4-methyl-2-pyridinyl)pyrrol-3-yl]-2-(2-fluorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3554169 |
| Molecular Formula | C21H18FN3 |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 3-[2,5-dimethyl-1-(4-methyl-2-pyridinyl)pyrrol-3-yl]-2-(2-fluorophenyl)prop-2-enenitrile |
| SMILES | Cc1ccnc(-n2c(C)cc(C=C(C#N)c3ccccc3F)c2C)c1 |
| InChI | InChI=1S/C21H18FN3/c1-14-8-9-24-21(10-14)25-15(2)11-17(16(25)3)12-18(13-23)19-6-4-5-7-20(19)22/h4-12H,1-3H3 |
| InChIKey | JNKZLIGISYNISO-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|