C22H19N3O2 — CID 4043017
4-[1-cyano-2-[2,5-dimethyl-1-(4-methyl-2-pyridinyl)pyrrol-3-yl]ethenyl]benzoic acid (PubChem CID 4043017) has the molecular formula C22H19N3O2 and a molecular weight of 357.41 g/mol. Its IUPAC name is 4-[1-cyano-2-[2,5-dimethyl-1-(4-methyl-2-pyridinyl)pyrrol-3-yl]ethenyl]benzoic acid.
| Compound Name | 4-[1-cyano-2-[2,5-dimethyl-1-(4-methyl-2-pyridinyl)pyrrol-3-yl]ethenyl]benzoic acid |
|---|---|
| PubChem CID | 4043017 |
| Molecular Formula | C22H19N3O2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 4-[1-cyano-2-[2,5-dimethyl-1-(4-methyl-2-pyridinyl)pyrrol-3-yl]ethenyl]benzoic acid |
| SMILES | Cc1ccnc(-n2c(C)cc(C=C(C#N)c3ccc(C(=O)O)cc3)c2C)c1 |
| InChI | InChI=1S/C22H19N3O2/c1-14-8-9-24-21(10-14)25-15(2)11-19(16(25)3)12-20(13-23)17-4-6-18(7-5-17)22(26)27/h4-12H,1-3H3,(H,26,27) |
| InChIKey | YMGNLAISCNZPHI-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|