C22H24ClN3O3 — CID 20928640
1-(5-chloro-2,4-dimethoxyphenyl)-3-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methyl]urea (PubChem CID 20928640) has the molecular formula C22H24ClN3O3 and a molecular weight of 413.91 g/mol. Its IUPAC name is 1-(5-chloro-2,4-dimethoxyphenyl)-3-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methyl]urea.
| Compound Name | 1-(5-chloro-2,4-dimethoxyphenyl)-3-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methyl]urea |
|---|---|
| PubChem CID | 20928640 |
| Molecular Formula | C22H24ClN3O3 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 1-(5-chloro-2,4-dimethoxyphenyl)-3-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methyl]urea |
| SMILES | COc1cc(OC)c(NC(=O)NCc2cc(C)n(-c3ccccc3)c2C)cc1Cl |
| InChI | InChI=1S/C22H24ClN3O3/c1-14-10-16(15(2)26(14)17-8-6-5-7-9-17)13-24-22(27)25-19-11-18(23)20(28-3)12-21(19)29-4/h5-12H,13H2,1-4H3,(H2,24,25,27) |
| InChIKey | WQNDHOCXJHIQLP-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|