C18H21ClN2O3S — CID 3817217
1-(2-benzylsulfanylethyl)-3-(5-chloro-2,4-dimethoxyphenyl)urea (PubChem CID 3817217) has the molecular formula C18H21ClN2O3S and a molecular weight of 380.90 g/mol. Its IUPAC name is 1-(2-benzylsulfanylethyl)-3-(5-chloro-2,4-dimethoxyphenyl)urea.
| Compound Name | 1-(2-benzylsulfanylethyl)-3-(5-chloro-2,4-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 3817217 |
| Molecular Formula | C18H21ClN2O3S |
| Molecular Weight | 380.90 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 1-(2-benzylsulfanylethyl)-3-(5-chloro-2,4-dimethoxyphenyl)urea |
| SMILES | COc1cc(OC)c(NC(=O)NCCSCc2ccccc2)cc1Cl |
| InChI | InChI=1S/C18H21ClN2O3S/c1-23-16-11-17(24-2)15(10-14(16)19)21-18(22)20-8-9-25-12-13-6-4-3-5-7-13/h3-7,10-11H,8-9,12H2,1-2H3,(H2,20,21,22) |
| InChIKey | OKQPVKLSZTWPOS-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.90 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|