C21H22FN3O2 — CID 20928479
1-[[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methyl]-3-(2-methoxyphenyl)urea (PubChem CID 20928479) has the molecular formula C21H22FN3O2 and a molecular weight of 367.42 g/mol. Its IUPAC name is 1-[[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methyl]-3-(2-methoxyphenyl)urea.
| Compound Name | 1-[[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methyl]-3-(2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 20928479 |
| Molecular Formula | C21H22FN3O2 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 1-[[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methyl]-3-(2-methoxyphenyl)urea |
| SMILES | COc1ccccc1NC(=O)NCc1cc(C)n(-c2ccc(F)cc2)c1C |
| InChI | InChI=1S/C21H22FN3O2/c1-14-12-16(15(2)25(14)18-10-8-17(22)9-11-18)13-23-21(26)24-19-6-4-5-7-20(19)27-3/h4-12H,13H2,1-3H3,(H2,23,24,26) |
| InChIKey | MHUATRNRFXOQJH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|