C23H27N3O2 — CID 20928452
1-(2,4-dimethylphenyl)-3-[[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methyl]urea (PubChem CID 20928452) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-3-[[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methyl]urea.
| Compound Name | 1-(2,4-dimethylphenyl)-3-[[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methyl]urea |
|---|---|
| PubChem CID | 20928452 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-3-[[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methyl]urea |
| SMILES | COc1ccc(-n2c(C)cc(CNC(=O)Nc3ccc(C)cc3C)c2C)cc1 |
| InChI | InChI=1S/C23H27N3O2/c1-15-6-11-22(16(2)12-15)25-23(27)24-14-19-13-17(3)26(18(19)4)20-7-9-21(28-5)10-8-20/h6-13H,14H2,1-5H3,(H2,24,25,27) |
| InChIKey | JFTWGGRYMHPDNV-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|