C24H27N3O4 — CID 20928441
ethyl 3-[[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylcarbamoylamino]benzoate (PubChem CID 20928441) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is ethyl 3-[[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylcarbamoylamino]benzoate.
| Compound Name | ethyl 3-[[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylcarbamoylamino]benzoate |
|---|---|
| PubChem CID | 20928441 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | ethyl 3-[[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylcarbamoylamino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)NCc2cc(C)n(-c3ccc(OC)cc3)c2C)c1 |
| InChI | InChI=1S/C24H27N3O4/c1-5-31-23(28)18-7-6-8-20(14-18)26-24(29)25-15-19-13-16(2)27(17(19)3)21-9-11-22(30-4)12-10-21/h6-14H,5,15H2,1-4H3,(H2,25,26,29) |
| InChIKey | QJXALPCPTUZFFM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|