C22H22F3N3O — CID 20928356
1-[[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]methyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 20928356) has the molecular formula C22H22F3N3O and a molecular weight of 401.43 g/mol. Its IUPAC name is 1-[[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]methyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]methyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 20928356 |
| Molecular Formula | C22H22F3N3O |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 1-[[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]methyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | Cc1ccc(-n2c(C)cc(CNC(=O)Nc3cccc(C(F)(F)F)c3)c2C)cc1 |
| InChI | InChI=1S/C22H22F3N3O/c1-14-7-9-20(10-8-14)28-15(2)11-17(16(28)3)13-26-21(29)27-19-6-4-5-18(12-19)22(23,24)25/h4-12H,13H2,1-3H3,(H2,26,27,29) |
| InChIKey | CQBYKAWVTQIBIC-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|