C16H18F3N5O — CID 91966996
1-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]methyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 91966996) has the molecular formula C16H18F3N5O and a molecular weight of 353.35 g/mol. Its IUPAC name is 1-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]methyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]methyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 91966996 |
| Molecular Formula | C16H18F3N5O |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 1-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]methyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | Cc1cc(N(C)C)nc(CNC(=O)Nc2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C16H18F3N5O/c1-10-7-14(24(2)3)23-13(21-10)9-20-15(25)22-12-6-4-5-11(8-12)16(17,18)19/h4-8H,9H2,1-3H3,(H2,20,22,25) |
| InChIKey | DBHZQGOYODGHJO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |