C14H14BrF3N4O — CID 19328827
1-[(4-bromo-1-ethylpyrazol-5-yl)methyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 19328827) has the molecular formula C14H14BrF3N4O and a molecular weight of 391.19 g/mol. Its IUPAC name is 1-[(4-bromo-1-ethylpyrazol-5-yl)methyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(4-bromo-1-ethylpyrazol-5-yl)methyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 19328827 |
| Molecular Formula | C14H14BrF3N4O |
| Molecular Weight | 391.19 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | 1-[(4-bromo-1-ethylpyrazol-5-yl)methyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | CCn1ncc(Br)c1CNC(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H14BrF3N4O/c1-2-22-12(11(15)7-20-22)8-19-13(23)21-10-5-3-4-9(6-10)14(16,17)18/h3-7H,2,8H2,1H3,(H2,19,21,23) |
| InChIKey | JXPYXUQNRVKFFR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.19 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |