C23H27N3O — CID 20928555
1-[[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]methyl]-3-(2,4-dimethylphenyl)urea (PubChem CID 20928555) has the molecular formula C23H27N3O and a molecular weight of 361.49 g/mol. Its IUPAC name is 1-[[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]methyl]-3-(2,4-dimethylphenyl)urea.
| Compound Name | 1-[[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]methyl]-3-(2,4-dimethylphenyl)urea |
|---|---|
| PubChem CID | 20928555 |
| Molecular Formula | C23H27N3O |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | 1-[[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]methyl]-3-(2,4-dimethylphenyl)urea |
| SMILES | Cc1cccc(-n2c(C)cc(CNC(=O)Nc3ccc(C)cc3C)c2C)c1 |
| InChI | InChI=1S/C23H27N3O/c1-15-7-6-8-21(12-15)26-18(4)13-20(19(26)5)14-24-23(27)25-22-10-9-16(2)11-17(22)3/h6-13H,14H2,1-5H3,(H2,24,25,27) |
| InChIKey | CYVQSOWQFHAXCB-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|