C21H22ClN3O — CID 20928587
1-[[1-(3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methyl]-3-(4-methylphenyl)urea (PubChem CID 20928587) has the molecular formula C21H22ClN3O and a molecular weight of 367.88 g/mol. Its IUPAC name is 1-[[1-(3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methyl]-3-(4-methylphenyl)urea.
| Compound Name | 1-[[1-(3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methyl]-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 20928587 |
| Molecular Formula | C21H22ClN3O |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 1-[[1-(3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methyl]-3-(4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)NCc2cc(C)n(-c3cccc(Cl)c3)c2C)cc1 |
| InChI | InChI=1S/C21H22ClN3O/c1-14-7-9-19(10-8-14)24-21(26)23-13-17-11-15(2)25(16(17)3)20-6-4-5-18(22)12-20/h4-12H,13H2,1-3H3,(H2,23,24,26) |
| InChIKey | XPOJQQHYDQAYFD-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|