C22H24FN3O — CID 20928482
1-(4-ethylphenyl)-3-[[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methyl]urea (PubChem CID 20928482) has the molecular formula C22H24FN3O and a molecular weight of 365.45 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-3-[[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methyl]urea.
| Compound Name | 1-(4-ethylphenyl)-3-[[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methyl]urea |
|---|---|
| PubChem CID | 20928482 |
| Molecular Formula | C22H24FN3O |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 1-(4-ethylphenyl)-3-[[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methyl]urea |
| SMILES | CCc1ccc(NC(=O)NCc2cc(C)n(-c3ccc(F)cc3)c2C)cc1 |
| InChI | InChI=1S/C22H24FN3O/c1-4-17-5-9-20(10-6-17)25-22(27)24-14-18-13-15(2)26(16(18)3)21-11-7-19(23)8-12-21/h5-13H,4,14H2,1-3H3,(H2,24,25,27) |
| InChIKey | ZNPRALXYIDPZNU-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|