C15H21Cl2N3O — CID 79113332
1-(4-aminocyclohexyl)-3-(2,5-dichlorophenyl)-1-ethylurea (PubChem CID 79113332) has the molecular formula C15H21Cl2N3O and a molecular weight of 330.26 g/mol. Its IUPAC name is 1-(4-aminocyclohexyl)-3-(2,5-dichlorophenyl)-1-ethylurea.
| Compound Name | 1-(4-aminocyclohexyl)-3-(2,5-dichlorophenyl)-1-ethylurea |
|---|---|
| PubChem CID | 79113332 |
| Molecular Formula | C15H21Cl2N3O |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 1-(4-aminocyclohexyl)-3-(2,5-dichlorophenyl)-1-ethylurea |
| SMILES | CCN(C(=O)Nc1cc(Cl)ccc1Cl)C1CCC(N)CC1 |
| InChI | InChI=1S/C15H21Cl2N3O/c1-2-20(12-6-4-11(18)5-7-12)15(21)19-14-9-10(16)3-8-13(14)17/h3,8-9,11-12H,2,4-7,18H2,1H3,(H,19,21) |
| InChIKey | DJFPVZZWUFGCTR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |