C30H35N3O2 — CID 141100697
1-butyl-3-phenyl-1-[1-(9H-xanthen-2-ylmethyl)piperidin-4-yl]urea (PubChem CID 141100697) has the molecular formula C30H35N3O2 and a molecular weight of 469.63 g/mol. Its IUPAC name is 1-butyl-3-phenyl-1-[1-(9H-xanthen-2-ylmethyl)piperidin-4-yl]urea.
| Compound Name | 1-butyl-3-phenyl-1-[1-(9H-xanthen-2-ylmethyl)piperidin-4-yl]urea |
|---|---|
| PubChem CID | 141100697 |
| Molecular Formula | C30H35N3O2 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | 1-butyl-3-phenyl-1-[1-(9H-xanthen-2-ylmethyl)piperidin-4-yl]urea |
| SMILES | CCCCN(C(=O)Nc1ccccc1)C1CCN(Cc2ccc3c(c2)Cc2ccccc2O3)CC1 |
| InChI | InChI=1S/C30H35N3O2/c1-2-3-17-33(30(34)31-26-10-5-4-6-11-26)27-15-18-32(19-16-27)22-23-13-14-29-25(20-23)21-24-9-7-8-12-28(24)35-29/h4-14,20,27H,2-3,15-19,21-22H2,1H3,(H,31,34) |
| InChIKey | HZVYGSLKBXECKF-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |