C22H21F2N3O2 — CID 162651161
N-(1-benzylpiperidin-4-yl)-5-(2,4-difluorophenyl)-1,2-oxazole-3-carboxamide (PubChem CID 162651161) has the molecular formula C22H21F2N3O2 and a molecular weight of 397.43 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-5-(2,4-difluorophenyl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-5-(2,4-difluorophenyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 162651161 |
| Molecular Formula | C22H21F2N3O2 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-5-(2,4-difluorophenyl)-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NC1CCN(Cc2ccccc2)CC1)c1cc(-c2ccc(F)cc2F)on1 |
| InChI | InChI=1S/C22H21F2N3O2/c23-16-6-7-18(19(24)12-16)21-13-20(26-29-21)22(28)25-17-8-10-27(11-9-17)14-15-4-2-1-3-5-15/h1-7,12-13,17H,8-11,14H2,(H,25,28) |
| InChIKey | RGWYWYOSBWFRBG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |