C13H13FN2O — CID 113205089
N-cyclopropyl-6-fluoro-3-methyl-1H-indole-2-carboxamide (PubChem CID 113205089) has the molecular formula C13H13FN2O and a molecular weight of 232.26 g/mol. Its IUPAC name is N-cyclopropyl-6-fluoro-3-methyl-1H-indole-2-carboxamide.
| Compound Name | N-cyclopropyl-6-fluoro-3-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 113205089 |
| Molecular Formula | C13H13FN2O |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | N-cyclopropyl-6-fluoro-3-methyl-1H-indole-2-carboxamide |
| SMILES | Cc1c(C(=O)NC2CC2)[nH]c2cc(F)ccc12 |
| InChI | InChI=1S/C13H13FN2O/c1-7-10-5-2-8(14)6-11(10)16-12(7)13(17)15-9-3-4-9/h2,5-6,9,16H,3-4H2,1H3,(H,15,17) |
| InChIKey | SYLPYNVSQYVUOQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|