C19H19FN2O — CID 113204989
N-[2-(4-fluorophenyl)ethyl]-3,6-dimethyl-1H-indole-2-carboxamide (PubChem CID 113204989) has the molecular formula C19H19FN2O and a molecular weight of 310.37 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-3,6-dimethyl-1H-indole-2-carboxamide.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-3,6-dimethyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 113204989 |
| Molecular Formula | C19H19FN2O |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-3,6-dimethyl-1H-indole-2-carboxamide |
| SMILES | Cc1ccc2c(C)c(C(=O)NCCc3ccc(F)cc3)[nH]c2c1 |
| InChI | InChI=1S/C19H19FN2O/c1-12-3-8-16-13(2)18(22-17(16)11-12)19(23)21-10-9-14-4-6-15(20)7-5-14/h3-8,11,22H,9-10H2,1-2H3,(H,21,23) |
| InChIKey | QPRSLFSLHIOWMN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|