C14H19N3O3S — CID 70730395
3,5-dimethyl-N-[2-(methylsulfamoyl)ethyl]-1H-indole-2-carboxamide (PubChem CID 70730395) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is 3,5-dimethyl-N-[2-(methylsulfamoyl)ethyl]-1H-indole-2-carboxamide.
| Compound Name | 3,5-dimethyl-N-[2-(methylsulfamoyl)ethyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 70730395 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 3,5-dimethyl-N-[2-(methylsulfamoyl)ethyl]-1H-indole-2-carboxamide |
| SMILES | CNS(=O)(=O)CCNC(=O)c1[nH]c2ccc(C)cc2c1C |
| InChI | InChI=1S/C14H19N3O3S/c1-9-4-5-12-11(8-9)10(2)13(17-12)14(18)16-6-7-21(19,20)15-3/h4-5,8,15,17H,6-7H2,1-3H3,(H,16,18) |
| InChIKey | WXNXIOMMFZYPFO-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|