C17H16N2O2 — CID 84578341
N-(2-hydroxyphenyl)-3,5-dimethyl-1H-indole-2-carboxamide (PubChem CID 84578341) has the molecular formula C17H16N2O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is N-(2-hydroxyphenyl)-3,5-dimethyl-1H-indole-2-carboxamide.
| Compound Name | N-(2-hydroxyphenyl)-3,5-dimethyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 84578341 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | N-(2-hydroxyphenyl)-3,5-dimethyl-1H-indole-2-carboxamide |
| SMILES | Cc1ccc2[nH]c(C(=O)Nc3ccccc3O)c(C)c2c1 |
| InChI | InChI=1S/C17H16N2O2/c1-10-7-8-13-12(9-10)11(2)16(18-13)17(21)19-14-5-3-4-6-15(14)20/h3-9,18,20H,1-2H3,(H,19,21) |
| InChIKey | GKDMSEDSDMNCHR-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|