C15H16FN3O2 — CID 119387295
7-fluoro-2-oxo-N-piperidin-4-yl-1H-quinoline-4-carboxamide (PubChem CID 119387295) has the molecular formula C15H16FN3O2 and a molecular weight of 289.31 g/mol. Its IUPAC name is 7-fluoro-2-oxo-N-piperidin-4-yl-1H-quinoline-4-carboxamide.
| Compound Name | 7-fluoro-2-oxo-N-piperidin-4-yl-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 119387295 |
| Molecular Formula | C15H16FN3O2 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 7-fluoro-2-oxo-N-piperidin-4-yl-1H-quinoline-4-carboxamide |
| SMILES | O=C(NC1CCNCC1)c1cc(=O)[nH]c2cc(F)ccc12 |
| InChI | InChI=1S/C15H16FN3O2/c16-9-1-2-11-12(8-14(20)19-13(11)7-9)15(21)18-10-3-5-17-6-4-10/h1-2,7-8,10,17H,3-6H2,(H,18,21)(H,19,20) |
| InChIKey | LPQNLANLYXTDJT-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |