C25H26FN3O2S — CID 55787262
N-(1-benzylpiperidin-4-yl)-5-[(3-fluorobenzoyl)amino]-3-methylthiophene-2-carboxamide (PubChem CID 55787262) has the molecular formula C25H26FN3O2S and a molecular weight of 451.57 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-5-[(3-fluorobenzoyl)amino]-3-methylthiophene-2-carboxamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-5-[(3-fluorobenzoyl)amino]-3-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 55787262 |
| Molecular Formula | C25H26FN3O2S |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-5-[(3-fluorobenzoyl)amino]-3-methylthiophene-2-carboxamide |
| SMILES | Cc1cc(NC(=O)c2cccc(F)c2)sc1C(=O)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H26FN3O2S/c1-17-14-22(28-24(30)19-8-5-9-20(26)15-19)32-23(17)25(31)27-21-10-12-29(13-11-21)16-18-6-3-2-4-7-18/h2-9,14-15,21H,10-13,16H2,1H3,(H,27,31)(H,28,30) |
| InChIKey | RCTCWGWTZOCCJX-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |