C23H22FN3O3S — CID 112834301
3-fluoro-N-[5-[4-(2-hydroxyphenyl)piperazine-1-carbonyl]-4-methylthiophen-2-yl]benzamide (PubChem CID 112834301) has the molecular formula C23H22FN3O3S and a molecular weight of 439.51 g/mol. Its IUPAC name is 3-fluoro-N-[5-[4-(2-hydroxyphenyl)piperazine-1-carbonyl]-4-methylthiophen-2-yl]benzamide.
| Compound Name | 3-fluoro-N-[5-[4-(2-hydroxyphenyl)piperazine-1-carbonyl]-4-methylthiophen-2-yl]benzamide |
|---|---|
| PubChem CID | 112834301 |
| Molecular Formula | C23H22FN3O3S |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 3-fluoro-N-[5-[4-(2-hydroxyphenyl)piperazine-1-carbonyl]-4-methylthiophen-2-yl]benzamide |
| SMILES | Cc1cc(NC(=O)c2cccc(F)c2)sc1C(=O)N1CCN(c2ccccc2O)CC1 |
| InChI | InChI=1S/C23H22FN3O3S/c1-15-13-20(25-22(29)16-5-4-6-17(24)14-16)31-21(15)23(30)27-11-9-26(10-12-27)18-7-2-3-8-19(18)28/h2-8,13-14,28H,9-12H2,1H3,(H,25,29) |
| InChIKey | VORZHYCMNVOVNF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |