C25H26FN3O3S — CID 55917926
3-fluoro-N-[5-[4-(4-methoxyphenyl)-1,4-diazepane-1-carbonyl]-4-methylthiophen-2-yl]benzamide (PubChem CID 55917926) has the molecular formula C25H26FN3O3S and a molecular weight of 467.57 g/mol. Its IUPAC name is 3-fluoro-N-[5-[4-(4-methoxyphenyl)-1,4-diazepane-1-carbonyl]-4-methylthiophen-2-yl]benzamide.
| Compound Name | 3-fluoro-N-[5-[4-(4-methoxyphenyl)-1,4-diazepane-1-carbonyl]-4-methylthiophen-2-yl]benzamide |
|---|---|
| PubChem CID | 55917926 |
| Molecular Formula | C25H26FN3O3S |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 3-fluoro-N-[5-[4-(4-methoxyphenyl)-1,4-diazepane-1-carbonyl]-4-methylthiophen-2-yl]benzamide |
| SMILES | COc1ccc(N2CCCN(C(=O)c3sc(NC(=O)c4cccc(F)c4)cc3C)CC2)cc1 |
| InChI | InChI=1S/C25H26FN3O3S/c1-17-15-22(27-24(30)18-5-3-6-19(26)16-18)33-23(17)25(31)29-12-4-11-28(13-14-29)20-7-9-21(32-2)10-8-20/h3,5-10,15-16H,4,11-14H2,1-2H3,(H,27,30) |
| InChIKey | VFWFDQXDOLWANP-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|