C27H34ClN5O2 — CID 101273760
6-chloro-N-[[1-[5-[(2-phenylacetyl)amino]pentyl]piperidin-4-yl]methyl]-1H-benzimidazole-4-carboxamide (PubChem CID 101273760) has the molecular formula C27H34ClN5O2 and a molecular weight of 496.06 g/mol. Its IUPAC name is 6-chloro-N-[[1-[5-[(2-phenylacetyl)amino]pentyl]piperidin-4-yl]methyl]-1H-benzimidazole-4-carboxamide.
| Compound Name | 6-chloro-N-[[1-[5-[(2-phenylacetyl)amino]pentyl]piperidin-4-yl]methyl]-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 101273760 |
| Molecular Formula | C27H34ClN5O2 |
| Molecular Weight | 496.06 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | 6-chloro-N-[[1-[5-[(2-phenylacetyl)amino]pentyl]piperidin-4-yl]methyl]-1H-benzimidazole-4-carboxamide |
| SMILES | O=C(Cc1ccccc1)NCCCCCN1CCC(CNC(=O)c2cc(Cl)cc3[nH]cnc23)CC1 |
| InChI | InChI=1S/C27H34ClN5O2/c28-22-16-23(26-24(17-22)31-19-32-26)27(35)30-18-21-9-13-33(14-10-21)12-6-2-5-11-29-25(34)15-20-7-3-1-4-8-20/h1,3-4,7-8,16-17,19,21H,2,5-6,9-15,18H2,(H,29,34)(H,30,35)(H,31,32) |
| InChIKey | HLUZPNOMINCAGN-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.06 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|