C18H25BrN4O — CID 11014701
6-bromo-N-[(1-butylpiperidin-4-yl)methyl]-1H-benzimidazole-4-carboxamide (PubChem CID 11014701) has the molecular formula C18H25BrN4O and a molecular weight of 393.33 g/mol. Its IUPAC name is 6-bromo-N-[(1-butylpiperidin-4-yl)methyl]-1H-benzimidazole-4-carboxamide.
| Compound Name | 6-bromo-N-[(1-butylpiperidin-4-yl)methyl]-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 11014701 |
| Molecular Formula | C18H25BrN4O |
| Molecular Weight | 393.33 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 6-bromo-N-[(1-butylpiperidin-4-yl)methyl]-1H-benzimidazole-4-carboxamide |
| SMILES | CCCCN1CCC(CNC(=O)c2cc(Br)cc3[nH]cnc23)CC1 |
| InChI | InChI=1S/C18H25BrN4O/c1-2-3-6-23-7-4-13(5-8-23)11-20-18(24)15-9-14(19)10-16-17(15)22-12-21-16/h9-10,12-13H,2-8,11H2,1H3,(H,20,24)(H,21,22) |
| InChIKey | VGFOSPYYONGKOF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |