C18H26Cl2N3OP — CID 134423011
3,5-dichloro-N-[[1-[2-(cyclopropylphosphanylamino)ethyl]piperidin-4-yl]methyl]benzamide (PubChem CID 134423011) has the molecular formula C18H26Cl2N3OP and a molecular weight of 402.31 g/mol. Its IUPAC name is 3,5-dichloro-N-[[1-[2-(cyclopropylphosphanylamino)ethyl]piperidin-4-yl]methyl]benzamide.
| Compound Name | 3,5-dichloro-N-[[1-[2-(cyclopropylphosphanylamino)ethyl]piperidin-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 134423011 |
| Molecular Formula | C18H26Cl2N3OP |
| Molecular Weight | 402.31 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 3,5-dichloro-N-[[1-[2-(cyclopropylphosphanylamino)ethyl]piperidin-4-yl]methyl]benzamide |
| SMILES | O=C(NCC1CCN(CCNPC2CC2)CC1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H26Cl2N3OP/c19-15-9-14(10-16(20)11-15)18(24)21-12-13-3-6-23(7-4-13)8-5-22-25-17-1-2-17/h9-11,13,17,22,25H,1-8,12H2,(H,21,24) |
| InChIKey | CSTCZKLGQQZRHX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.31 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|