C18H17Cl2N5O — CID 121109940
3,5-dichloro-N-[[1-(3-cyanopyrazin-2-yl)piperidin-4-yl]methyl]benzamide (PubChem CID 121109940) has the molecular formula C18H17Cl2N5O and a molecular weight of 390.27 g/mol. Its IUPAC name is 3,5-dichloro-N-[[1-(3-cyanopyrazin-2-yl)piperidin-4-yl]methyl]benzamide.
| Compound Name | 3,5-dichloro-N-[[1-(3-cyanopyrazin-2-yl)piperidin-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 121109940 |
| Molecular Formula | C18H17Cl2N5O |
| Molecular Weight | 390.27 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 3,5-dichloro-N-[[1-(3-cyanopyrazin-2-yl)piperidin-4-yl]methyl]benzamide |
| SMILES | N#Cc1nccnc1N1CCC(CNC(=O)c2cc(Cl)cc(Cl)c2)CC1 |
| InChI | InChI=1S/C18H17Cl2N5O/c19-14-7-13(8-15(20)9-14)18(26)24-11-12-1-5-25(6-2-12)17-16(10-21)22-3-4-23-17/h3-4,7-9,12H,1-2,5-6,11H2,(H,24,26) |
| InChIKey | OJMAZWHLQPEJJT-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.27 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |