C21H24N6O3 — CID 121110119
N-[[1-(3-cyanopyrazin-2-yl)piperidin-4-yl]methyl]-N'-[(4-methoxyphenyl)methyl]oxamide (PubChem CID 121110119) has the molecular formula C21H24N6O3 and a molecular weight of 408.46 g/mol. Its IUPAC name is N-[[1-(3-cyanopyrazin-2-yl)piperidin-4-yl]methyl]-N'-[(4-methoxyphenyl)methyl]oxamide.
| Compound Name | N-[[1-(3-cyanopyrazin-2-yl)piperidin-4-yl]methyl]-N'-[(4-methoxyphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 121110119 |
| Molecular Formula | C21H24N6O3 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | N-[[1-(3-cyanopyrazin-2-yl)piperidin-4-yl]methyl]-N'-[(4-methoxyphenyl)methyl]oxamide |
| SMILES | COc1ccc(CNC(=O)C(=O)NCC2CCN(c3nccnc3C#N)CC2)cc1 |
| InChI | InChI=1S/C21H24N6O3/c1-30-17-4-2-15(3-5-17)13-25-20(28)21(29)26-14-16-6-10-27(11-7-16)19-18(12-22)23-8-9-24-19/h2-5,8-9,16H,6-7,10-11,13-14H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | KJDPDJGNHJYEJU-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|