About N-[[1-[2-(tert-butylcarbamoylamino)ethyl]piperidin-4-yl]methyl]-3,5-dichlorobenzamide
N-[[1-[2-(tert-butylcarbamoylamino)ethyl]piperidin-4-yl]methyl]-3,5-dichlorobenzamide (PubChem CID 71517047) has the molecular formula C20H30Cl2N4O2
and a molecular weight of 429.39 g/mol. Its IUPAC name is N-[[1-[2-(tert-butylcarbamoylamino)ethyl]piperidin-4-yl]methyl]-3,5-dichlorobenzamide.
Molecular Properties
| Compound Name | N-[[1-[2-(tert-butylcarbamoylamino)ethyl]piperidin-4-yl]methyl]-3,5-dichlorobenzamide |
| PubChem CID | 71517047 |
| Molecular Formula | C20H30Cl2N4O2 |
| Molecular Weight | 429.39 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | N-[[1-[2-(tert-butylcarbamoylamino)ethyl]piperidin-4-yl]methyl]-3,5-dichlorobenzamide |
| SMILES | CC(C)(C)NC(=O)NCCN1CCC(CNC(=O)c2cc(Cl)cc(Cl)c2)CC1 |
| InChI | InChI=1S/C20H30Cl2N4O2/c1-20(2,3)25-19(28)23-6-9-26-7-4-14(5-8-26)13-24-18(27)15-10-16(21)12-17(22)11-15/h10-12,14H,4-9,13H2,1-3H3,(H,24,27)(H2,23,25,28) |
| InChIKey | KOKMRCHGGOOAKB-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[1-[2-(tert-butylcarbamoylamino)ethyl]piperidin-4-yl]methyl]-3,5-dichlorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-[2-(tert-butylcarbamoylamino)ethyl]piperidin-4-yl]methyl]-3,5-dichlorobenzamide?
The IUPAC name of N-[[1-[2-(tert-butylcarbamoylamino)ethyl]piperidin-4-yl]methyl]-3,5-dichlorobenzamide (CID 71517047) is N-[[1-[2-(tert-butylcarbamoylamino)ethyl]piperidin-4-yl]methyl]-3,5-dichlorobenzamide.
What is the SMILES notation for N-[[1-[2-(tert-butylcarbamoylamino)ethyl]piperidin-4-yl]methyl]-3,5-dichlorobenzamide?
The canonical SMILES for N-[[1-[2-(tert-butylcarbamoylamino)ethyl]piperidin-4-yl]methyl]-3,5-dichlorobenzamide is CC(C)(C)NC(=O)NCCN1CCC(CNC(=O)c2cc(Cl)cc(Cl)c2)CC1.
What is the InChIKey of N-[[1-[2-(tert-butylcarbamoylamino)ethyl]piperidin-4-yl]methyl]-3,5-dichlorobenzamide?
The InChIKey is KOKMRCHGGOOAKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30Cl2N4O2/c1-20(2,3)25-19(28)23-6-9-26-7-4-14(5-8-26)13-24-18(27)15-10-16(21)12-17(22)11-15/h10-12,14H,4-9,13H2,1-3H3,(H,24,27)(H2,23,25,28).
What are the key properties of N-[[1-[2-(tert-butylcarbamoylamino)ethyl]piperidin-4-yl]methyl]-3,5-dichlorobenzamide?
N-[[1-[2-(tert-butylcarbamoylamino)ethyl]piperidin-4-yl]methyl]-3,5-dichlorobenzamide has a molecular weight of 429.39 g/mol, XLogP of 3.53, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-[2-(tert-butylcarbamoylamino)ethyl]piperidin-4-yl]methyl]-3,5-dichlorobenzamide is sourced from PubChem (CID 71517047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).