C15H18ClFN2O2 — CID 146616862
3-chloro-5-fluoro-N-[[1-(2-oxoethyl)piperidin-4-yl]methyl]benzamide (PubChem CID 146616862) has the molecular formula C15H18ClFN2O2 and a molecular weight of 312.77 g/mol. Its IUPAC name is 3-chloro-5-fluoro-N-[[1-(2-oxoethyl)piperidin-4-yl]methyl]benzamide.
| Compound Name | 3-chloro-5-fluoro-N-[[1-(2-oxoethyl)piperidin-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 146616862 |
| Molecular Formula | C15H18ClFN2O2 |
| Molecular Weight | 312.77 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 3-chloro-5-fluoro-N-[[1-(2-oxoethyl)piperidin-4-yl]methyl]benzamide |
| SMILES | O=CCN1CCC(CNC(=O)c2cc(F)cc(Cl)c2)CC1 |
| InChI | InChI=1S/C15H18ClFN2O2/c16-13-7-12(8-14(17)9-13)15(21)18-10-11-1-3-19(4-2-11)5-6-20/h6-9,11H,1-5,10H2,(H,18,21) |
| InChIKey | NZPCAFMPWWFSPP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.77 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|