C15H14B4ClFN2O3 — CID 163296590
CID 163296590 (PubChem CID 163296590) has the molecular formula C15H14B4ClFN2O3 and a molecular weight of 367.99 g/mol.
| Compound Name | CID 163296590 |
|---|---|
| PubChem CID | 163296590 |
| Molecular Formula | C15H14B4ClFN2O3 |
| Molecular Weight | 367.99 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | — |
| SMILES | [B]C1([B])CC(CNC(=O)c2cc(F)cc(Cl)c2)CC([B])([B])N1CC(=O)O |
| InChI | InChI=1S/C15H14B4ClFN2O3/c16-14(17)4-8(5-15(18,19)23(14)7-12(24)25)6-22-13(26)9-1-10(20)3-11(21)2-9/h1-3,8H,4-7H2,(H,22,26)(H,24,25) |
| InChIKey | ZFKICGMQHYKLNZ-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.99 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|